C19H28N2O3+2 — CID 7645882
4-[[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]methyl]-6-propan-2-ylchromen-2-one (PubChem CID 7645882) has the molecular formula C19H28N2O3+2 and a molecular weight of 332.44 g/mol. Its IUPAC name is 4-[[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]methyl]-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]methyl]-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 7645882 |
| Molecular Formula | C19H28N2O3+2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 4-[[4-(2-hydroxyethyl)piperazine-1,4-diium-1-yl]methyl]-6-propan-2-ylchromen-2-one |
| SMILES | CC(C)c1ccc2oc(=O)cc(C[NH+]3CC[NH+](CCO)CC3)c2c1 |
| InChI | InChI=1S/C19H26N2O3/c1-14(2)15-3-4-18-17(11-15)16(12-19(23)24-18)13-21-7-5-20(6-8-21)9-10-22/h3-4,11-12,14,22H,5-10,13H2,1-2H3/p+2 |
| InChIKey | GKRFVXWOUIPAML-UHFFFAOYSA-P |
| XLogP | -0.81 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|