C21H23Cl3N2O3 — CID 44664206
6-chloro-4-[[4-(2-methoxyphenyl)piperazine-1,4-diium-1-yl]methyl]chromen-2-one dichloride (PubChem CID 44664206) has the molecular formula C21H23Cl3N2O3 and a molecular weight of 457.79 g/mol. Its IUPAC name is 6-chloro-4-[[4-(2-methoxyphenyl)piperazine-1,4-diium-1-yl]methyl]chromen-2-one dichloride.
| Compound Name | 6-chloro-4-[[4-(2-methoxyphenyl)piperazine-1,4-diium-1-yl]methyl]chromen-2-one dichloride |
|---|---|
| PubChem CID | 44664206 |
| Molecular Formula | C21H23Cl3N2O3 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 6-chloro-4-[[4-(2-methoxyphenyl)piperazine-1,4-diium-1-yl]methyl]chromen-2-one dichloride |
| SMILES | COc1ccccc1[NH+]1CC[NH+](Cc2cc(=O)oc3ccc(Cl)cc23)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C21H21ClN2O3.2ClH/c1-26-20-5-3-2-4-18(20)24-10-8-23(9-11-24)14-15-12-21(25)27-19-7-6-16(22)13-17(15)19;;/h2-7,12-13H,8-11,14H2,1H3;2*1H |
| InChIKey | KMDCONCHZUMYIJ-UHFFFAOYSA-N |
| XLogP | -4.92 |
| TPSA | 48.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | -4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|