C19H26N2O2 — CID 4893279
4-[(4-ethylpiperazin-1-yl)methyl]-6-propan-2-ylchromen-2-one (PubChem CID 4893279) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-[(4-ethylpiperazin-1-yl)methyl]-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[(4-ethylpiperazin-1-yl)methyl]-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 4893279 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 4-[(4-ethylpiperazin-1-yl)methyl]-6-propan-2-ylchromen-2-one |
| SMILES | CCN1CCN(Cc2cc(=O)oc3ccc(C(C)C)cc23)CC1 |
| InChI | InChI=1S/C19H26N2O2/c1-4-20-7-9-21(10-8-20)13-16-12-19(22)23-18-6-5-15(14(2)3)11-17(16)18/h5-6,11-12,14H,4,7-10,13H2,1-3H3 |
| InChIKey | JXEPWHVYHXCEJQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|