C14H16NO5+ — CID 6918978
6,7-dihydroxy-4-(morpholin-4-ium-4-ylmethyl)chromen-2-one (PubChem CID 6918978) has the molecular formula C14H16NO5+ and a molecular weight of 278.28 g/mol. Its IUPAC name is 6,7-dihydroxy-4-(morpholin-4-ium-4-ylmethyl)chromen-2-one.
| Compound Name | 6,7-dihydroxy-4-(morpholin-4-ium-4-ylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 6918978 |
| Molecular Formula | C14H16NO5+ |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 6,7-dihydroxy-4-(morpholin-4-ium-4-ylmethyl)chromen-2-one |
| SMILES | O=c1cc(C[NH+]2CCOCC2)c2cc(O)c(O)cc2o1 |
| InChI | InChI=1S/C14H15NO5/c16-11-6-10-9(8-15-1-3-19-4-2-15)5-14(18)20-13(10)7-12(11)17/h5-7,16-17H,1-4,8H2/p+1 |
| InChIKey | FZRNEERXGKQYPH-UHFFFAOYSA-O |
| XLogP | -0.38 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|