C16H18NO5S+ — CID 8549777
methyl (2R)-4-[(7-hydroxy-2-oxochromen-4-yl)methyl]thiomorpholin-4-ium-2-carboxylate (PubChem CID 8549777) has the molecular formula C16H18NO5S+ and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl (2R)-4-[(7-hydroxy-2-oxochromen-4-yl)methyl]thiomorpholin-4-ium-2-carboxylate.
| Compound Name | methyl (2R)-4-[(7-hydroxy-2-oxochromen-4-yl)methyl]thiomorpholin-4-ium-2-carboxylate |
|---|---|
| PubChem CID | 8549777 |
| Molecular Formula | C16H18NO5S+ |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | methyl (2R)-4-[(7-hydroxy-2-oxochromen-4-yl)methyl]thiomorpholin-4-ium-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[NH+](Cc2cc(=O)oc3cc(O)ccc23)CCS1 |
| InChI | InChI=1S/C16H17NO5S/c1-21-16(20)14-9-17(4-5-23-14)8-10-6-15(19)22-13-7-11(18)2-3-12(10)13/h2-3,6-7,14,18H,4-5,8-9H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | GFQQNIRDHFYVJO-CQSZACIVSA-O |
| XLogP | 0.17 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|