C23H23ClFNO3 — CID 110275379
(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-6-hydroxy-4-methyl-7-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-one (PubChem CID 110275379) has the molecular formula C23H23ClFNO3 and a molecular weight of 415.89 g/mol. Its IUPAC name is (2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-6-hydroxy-4-methyl-7-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-6-hydroxy-4-methyl-7-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 110275379 |
| Molecular Formula | C23H23ClFNO3 |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-6-hydroxy-4-methyl-7-[(2-methylpiperidin-1-yl)methyl]-1-benzofuran-3-one |
| SMILES | Cc1cc(O)c(CN2CCCCC2C)c2c1C(=O)/C(=C/c1c(F)cccc1Cl)O2 |
| InChI | InChI=1S/C23H23ClFNO3/c1-13-10-19(27)16(12-26-9-4-3-6-14(26)2)23-21(13)22(28)20(29-23)11-15-17(24)7-5-8-18(15)25/h5,7-8,10-11,14,27H,3-4,6,9,12H2,1-2H3/b20-11- |
| InChIKey | SYYVLRBOJOUADX-JAIQZWGSSA-N |
| XLogP | 5.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|