C25H27NO8S — CID 110275986
(7Z)-3-(1,1-dioxothiolan-3-yl)-9-methyl-7-[(3,4,5-trimethoxyphenyl)methylidene]-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one (PubChem CID 110275986) has the molecular formula C25H27NO8S and a molecular weight of 501.56 g/mol. Its IUPAC name is (7Z)-3-(1,1-dioxothiolan-3-yl)-9-methyl-7-[(3,4,5-trimethoxyphenyl)methylidene]-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one.
| Compound Name | (7Z)-3-(1,1-dioxothiolan-3-yl)-9-methyl-7-[(3,4,5-trimethoxyphenyl)methylidene]-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one |
|---|---|
| PubChem CID | 110275986 |
| Molecular Formula | C25H27NO8S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | (7Z)-3-(1,1-dioxothiolan-3-yl)-9-methyl-7-[(3,4,5-trimethoxyphenyl)methylidene]-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one |
| SMILES | COc1cc(/C=C2\Oc3c(cc4c(c3C)OCN(C3CCS(=O)(=O)C3)C4)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H27NO8S/c1-14-23-16(11-26(13-33-23)17-5-6-35(28,29)12-17)10-18-22(27)19(34-24(14)18)7-15-8-20(30-2)25(32-4)21(9-15)31-3/h7-10,17H,5-6,11-13H2,1-4H3/b19-7- |
| InChIKey | RDFUIHHYANYZAG-GXHLCREISA-N |
| XLogP | 2.98 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|