C23H23NO6S — CID 110276322
(2E)-8-(1,1-dioxothiolan-3-yl)-2-[(4-ethoxyphenyl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one (PubChem CID 110276322) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is (2E)-8-(1,1-dioxothiolan-3-yl)-2-[(4-ethoxyphenyl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one.
| Compound Name | (2E)-8-(1,1-dioxothiolan-3-yl)-2-[(4-ethoxyphenyl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
|---|---|
| PubChem CID | 110276322 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (2E)-8-(1,1-dioxothiolan-3-yl)-2-[(4-ethoxyphenyl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
| SMILES | CCOc1ccc(/C=C2/Oc3c(ccc4c3CN(C3CCS(=O)(=O)C3)CO4)C2=O)cc1 |
| InChI | InChI=1S/C23H23NO6S/c1-2-28-17-5-3-15(4-6-17)11-21-22(25)18-7-8-20-19(23(18)30-21)12-24(14-29-20)16-9-10-31(26,27)13-16/h3-8,11,16H,2,9-10,12-14H2,1H3/b21-11+ |
| InChIKey | MVVMJSJVTKOYCC-SRZZPIQSSA-N |
| XLogP | 3.04 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|