C21H21NO6S — CID 110276236
(2Z)-8-(1,1-dioxothiolan-3-yl)-4-methyl-2-[(5-methylfuran-2-yl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one (PubChem CID 110276236) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is (2Z)-8-(1,1-dioxothiolan-3-yl)-4-methyl-2-[(5-methylfuran-2-yl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one.
| Compound Name | (2Z)-8-(1,1-dioxothiolan-3-yl)-4-methyl-2-[(5-methylfuran-2-yl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
|---|---|
| PubChem CID | 110276236 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (2Z)-8-(1,1-dioxothiolan-3-yl)-4-methyl-2-[(5-methylfuran-2-yl)methylidene]-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
| SMILES | Cc1ccc(/C=C2\Oc3c4c(cc(C)c3C2=O)OCN(C2CCS(=O)(=O)C2)C4)o1 |
| InChI | InChI=1S/C21H21NO6S/c1-12-7-17-16(9-22(11-26-17)14-5-6-29(24,25)10-14)21-19(12)20(23)18(28-21)8-15-4-3-13(2)27-15/h3-4,7-8,14H,5-6,9-11H2,1-2H3/b18-8- |
| InChIKey | ZXJSRYWIZWZXFF-LSCVHKIXSA-N |
| XLogP | 2.85 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|