C21H17Cl2NO5S — CID 110276319
(2Z)-2-[(2,6-dichlorophenyl)methylidene]-8-(1,1-dioxothiolan-3-yl)-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one (PubChem CID 110276319) has the molecular formula C21H17Cl2NO5S and a molecular weight of 466.34 g/mol. Its IUPAC name is (2Z)-2-[(2,6-dichlorophenyl)methylidene]-8-(1,1-dioxothiolan-3-yl)-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one.
| Compound Name | (2Z)-2-[(2,6-dichlorophenyl)methylidene]-8-(1,1-dioxothiolan-3-yl)-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
|---|---|
| PubChem CID | 110276319 |
| Molecular Formula | C21H17Cl2NO5S |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | (2Z)-2-[(2,6-dichlorophenyl)methylidene]-8-(1,1-dioxothiolan-3-yl)-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one |
| SMILES | O=C1/C(=C/c2c(Cl)cccc2Cl)Oc2c1ccc1c2CN(C2CCS(=O)(=O)C2)CO1 |
| InChI | InChI=1S/C21H17Cl2NO5S/c22-16-2-1-3-17(23)14(16)8-19-20(25)13-4-5-18-15(21(13)29-19)9-24(11-28-18)12-6-7-30(26,27)10-12/h1-5,8,12H,6-7,9-11H2/b19-8- |
| InChIKey | HSSMIVLXZMZTKE-UWVJOHFNSA-N |
| XLogP | 3.95 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|