C22H22N2O3 — CID 78149198
3-cyclopentyl-9-methyl-7-(pyridin-3-ylmethylidene)-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one (PubChem CID 78149198) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-cyclopentyl-9-methyl-7-(pyridin-3-ylmethylidene)-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one.
| Compound Name | 3-cyclopentyl-9-methyl-7-(pyridin-3-ylmethylidene)-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one |
|---|---|
| PubChem CID | 78149198 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-cyclopentyl-9-methyl-7-(pyridin-3-ylmethylidene)-2,4-dihydrofuro[3,2-g][1,3]benzoxazin-6-one |
| SMILES | Cc1c2c(cc3c1OC(=Cc1cccnc1)C3=O)CN(C1CCCC1)CO2 |
| InChI | InChI=1S/C22H22N2O3/c1-14-21-16(12-24(13-26-21)17-6-2-3-7-17)10-18-20(25)19(27-22(14)18)9-15-5-4-8-23-11-15/h4-5,8-11,17H,2-3,6-7,12-13H2,1H3 |
| InChIKey | KMVAWOQAACYTMV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|