C22H23NO6 — CID 110276543
3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2-(3-methoxy-4-propoxyphenyl)-1-methyl-2H-pyrrol-5-one (PubChem CID 110276543) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2-(3-methoxy-4-propoxyphenyl)-1-methyl-2H-pyrrol-5-one.
| Compound Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2-(3-methoxy-4-propoxyphenyl)-1-methyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 110276543 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2-(3-methoxy-4-propoxyphenyl)-1-methyl-2H-pyrrol-5-one |
| SMILES | CCCOc1ccc(C2C(C(=O)/C=C/c3ccco3)=C(O)C(=O)N2C)cc1OC |
| InChI | InChI=1S/C22H23NO6/c1-4-11-29-17-10-7-14(13-18(17)27-3)20-19(21(25)22(26)23(20)2)16(24)9-8-15-6-5-12-28-15/h5-10,12-13,20,25H,4,11H2,1-3H3/b9-8+ |
| InChIKey | OPDXKQGYCVSIPB-CMDGGOBGSA-N |
| XLogP | 3.68 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|