C28H38N2O8 — CID 11027834
tert-butyl (1S,2S,4R,7S,8R)-7-(2-ethoxy-2-oxoethyl)-2-formyl-2-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-5-oxo-6,11-diazatricyclo[5.4.0.04,8]undecane-11-carboxylate (PubChem CID 11027834) has the molecular formula C28H38N2O8 and a molecular weight of 530.62 g/mol. Its IUPAC name is tert-butyl (1S,2S,4R,7S,8R)-7-(2-ethoxy-2-oxoethyl)-2-formyl-2-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-5-oxo-6,11-diazatricyclo[5.4.0.04,8]undecane-11-carboxylate.
| Compound Name | tert-butyl (1S,2S,4R,7S,8R)-7-(2-ethoxy-2-oxoethyl)-2-formyl-2-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-5-oxo-6,11-diazatricyclo[5.4.0.04,8]undecane-11-carboxylate |
|---|---|
| PubChem CID | 11027834 |
| Molecular Formula | C28H38N2O8 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | tert-butyl (1S,2S,4R,7S,8R)-7-(2-ethoxy-2-oxoethyl)-2-formyl-2-(hydroxymethyl)-6-[(4-methoxyphenyl)methyl]-5-oxo-6,11-diazatricyclo[5.4.0.04,8]undecane-11-carboxylate |
| SMILES | CCOC(=O)C[C@]12[C@@H]3CCN(C(=O)OC(C)(C)C)[C@H]1[C@](C=O)(CO)C[C@H]3C(=O)N2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H38N2O8/c1-6-37-22(33)14-28-21-11-12-29(25(35)38-26(2,3)4)24(28)27(16-31,17-32)13-20(21)23(34)30(28)15-18-7-9-19(36-5)10-8-18/h7-10,16,20-21,24,32H,6,11-15,17H2,1-5H3/t20-,21-,24+,27-,28+/m1/s1 |
| InChIKey | YQYUAKHTDXJLHU-OHUVHDHSSA-N |
| XLogP | 2.55 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|