C19H18F2N2O5S — CID 1102785
dimethyl 4-[2-(difluoromethoxy)-5-isothiocyanatophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 1102785) has the molecular formula C19H18F2N2O5S and a molecular weight of 424.43 g/mol. Its IUPAC name is dimethyl 4-[2-(difluoromethoxy)-5-isothiocyanatophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[2-(difluoromethoxy)-5-isothiocyanatophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 1102785 |
| Molecular Formula | C19H18F2N2O5S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | dimethyl 4-[2-(difluoromethoxy)-5-isothiocyanatophenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cc(N=C=S)ccc1OC(F)F |
| InChI | InChI=1S/C19H18F2N2O5S/c1-9-14(17(24)26-3)16(15(10(2)23-9)18(25)27-4)12-7-11(22-8-29)5-6-13(12)28-19(20)21/h5-7,16,19,23H,1-4H3 |
| InChIKey | DCUAKIOEASVOCK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|