C32H39F2NO8 — CID 11029032
N-[(3,5-difluorophenyl)methyl]-1-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-30-yl)methanamine (PubChem CID 11029032) has the molecular formula C32H39F2NO8 and a molecular weight of 603.66 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-1-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-30-yl)methanamine.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-1-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-30-yl)methanamine |
|---|---|
| PubChem CID | 11029032 |
| Molecular Formula | C32H39F2NO8 |
| Molecular Weight | 603.66 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-1-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-30-yl)methanamine |
| SMILES | Fc1cc(F)cc(CNCc2cc3cc(c2)OCCOCCOCCOc2ccccc2OCCOCCOCCO3)c1 |
| InChI | InChI=1S/C32H39F2NO8/c33-27-17-25(18-28(34)21-27)23-35-24-26-19-29-22-30(20-26)41-14-10-37-6-8-39-12-16-43-32-4-2-1-3-31(32)42-15-11-38-7-5-36-9-13-40-29/h1-4,17-22,35H,5-16,23-24H2 |
| InChIKey | HTAXJIFTSIFRJR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |