C25H34N2O9 — CID 139195802
2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene-30-carbohydrazide (PubChem CID 139195802) has the molecular formula C25H34N2O9 and a molecular weight of 506.55 g/mol. Its IUPAC name is 2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene-30-carbohydrazide.
| Compound Name | 2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene-30-carbohydrazide |
|---|---|
| PubChem CID | 139195802 |
| Molecular Formula | C25H34N2O9 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene-30-carbohydrazide |
| SMILES | NNC(=O)c1cc2cc(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C25H34N2O9/c26-27-25(28)20-17-21-19-22(18-20)34-14-10-30-6-8-32-12-16-36-24-4-2-1-3-23(24)35-15-11-31-7-5-29-9-13-33-21/h1-4,17-19H,5-16,26H2,(H,27,28) |
| InChIKey | GRVGTWFZWGYRQQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|