C30H40O14 — CID 10394164
2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaene-17,35-dicarboxylic acid (PubChem CID 10394164) has the molecular formula C30H40O14 and a molecular weight of 624.64 g/mol. Its IUPAC name is 2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaene-17,35-dicarboxylic acid.
| Compound Name | 2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaene-17,35-dicarboxylic acid |
|---|---|
| PubChem CID | 10394164 |
| Molecular Formula | C30H40O14 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaene-17,35-dicarboxylic acid |
| SMILES | O=C(O)c1cc2cc(c1)OCCOCCOCCOCCOc1cc(cc(C(=O)O)c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C30H40O14/c31-29(32)23-17-25-21-26(18-23)43-15-11-39-7-3-36-4-8-40-12-16-44-28-20-24(30(33)34)19-27(22-28)42-14-10-38-6-2-35-1-5-37-9-13-41-25/h17-22H,1-16H2,(H,31,32)(H,33,34) |
| InChIKey | ATFORLAVFARIDO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 166.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |