C22H24O10 — CID 102329109
2,5,8,14,17,20-hexaoxatricyclo[19.3.1.19,13]hexacosa-1(25),9(26),10,12,21,23-hexaene-11,23-dicarboxylic acid (PubChem CID 102329109) has the molecular formula C22H24O10 and a molecular weight of 448.42 g/mol. Its IUPAC name is 2,5,8,14,17,20-hexaoxatricyclo[19.3.1.19,13]hexacosa-1(25),9(26),10,12,21,23-hexaene-11,23-dicarboxylic acid.
| Compound Name | 2,5,8,14,17,20-hexaoxatricyclo[19.3.1.19,13]hexacosa-1(25),9(26),10,12,21,23-hexaene-11,23-dicarboxylic acid |
|---|---|
| PubChem CID | 102329109 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2,5,8,14,17,20-hexaoxatricyclo[19.3.1.19,13]hexacosa-1(25),9(26),10,12,21,23-hexaene-11,23-dicarboxylic acid |
| SMILES | O=C(O)c1cc2cc(c1)OCCOCCOc1cc(cc(C(=O)O)c1)OCCOCCO2 |
| InChI | InChI=1S/C22H24O10/c23-21(24)15-9-17-13-18(10-15)31-7-3-28-4-8-32-20-12-16(22(25)26)11-19(14-20)30-6-2-27-1-5-29-17/h9-14H,1-8H2,(H,23,24)(H,25,26) |
| InChIKey | PEKYFINLTSHRPJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |