C14H21NO3S — CID 110292406
3,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine (PubChem CID 110292406) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine.
| Compound Name | 3,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine |
|---|---|
| PubChem CID | 110292406 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3,5-dimethyl-4-[(4-methylphenyl)methylsulfonyl]morpholine |
| SMILES | Cc1ccc(CS(=O)(=O)N2C(C)COCC2C)cc1 |
| InChI | InChI=1S/C14H21NO3S/c1-11-4-6-14(7-5-11)10-19(16,17)15-12(2)8-18-9-13(15)3/h4-7,12-13H,8-10H2,1-3H3 |
| InChIKey | IHINAWBIQQCQIA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |