C18H21N3O3 — CID 110295412
4-(4-methoxyphenyl)-6-(3-methylpiperidine-1-carbonyl)-1H-pyrimidin-2-one (PubChem CID 110295412) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6-(3-methylpiperidine-1-carbonyl)-1H-pyrimidin-2-one.
| Compound Name | 4-(4-methoxyphenyl)-6-(3-methylpiperidine-1-carbonyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 110295412 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-6-(3-methylpiperidine-1-carbonyl)-1H-pyrimidin-2-one |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCCC(C)C3)[nH]c(=O)n2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-4-3-9-21(11-12)17(22)16-10-15(19-18(23)20-16)13-5-7-14(24-2)8-6-13/h5-8,10,12H,3-4,9,11H2,1-2H3,(H,19,20,23) |
| InChIKey | LWGCZLMPMDMRKH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |