C18H21N3O2 — CID 110332158
4-(4-methylphenyl)-6-(4-methylpiperidine-1-carbonyl)-1H-pyrimidin-2-one (PubChem CID 110332158) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-(4-methylphenyl)-6-(4-methylpiperidine-1-carbonyl)-1H-pyrimidin-2-one.
| Compound Name | 4-(4-methylphenyl)-6-(4-methylpiperidine-1-carbonyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 110332158 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-(4-methylphenyl)-6-(4-methylpiperidine-1-carbonyl)-1H-pyrimidin-2-one |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCC(C)CC3)[nH]c(=O)n2)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-3-5-14(6-4-12)15-11-16(20-18(23)19-15)17(22)21-9-7-13(2)8-10-21/h3-6,11,13H,7-10H2,1-2H3,(H,19,20,23) |
| InChIKey | QBPGULMKMSLJDB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |