C17H19N3O2 — CID 110332406
4-(2,5-dimethylphenyl)-6-(pyrrolidine-1-carbonyl)-1H-pyrimidin-2-one (PubChem CID 110332406) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-6-(pyrrolidine-1-carbonyl)-1H-pyrimidin-2-one.
| Compound Name | 4-(2,5-dimethylphenyl)-6-(pyrrolidine-1-carbonyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 110332406 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-6-(pyrrolidine-1-carbonyl)-1H-pyrimidin-2-one |
| SMILES | Cc1ccc(C)c(-c2cc(C(=O)N3CCCC3)[nH]c(=O)n2)c1 |
| InChI | InChI=1S/C17H19N3O2/c1-11-5-6-12(2)13(9-11)14-10-15(19-17(22)18-14)16(21)20-7-3-4-8-20/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,18,19,22) |
| InChIKey | JFNYGBBWPGAXII-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |