C11H11Cl2N3O2S2 — CID 110301352
5,6-dichloro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 110301352) has the molecular formula C11H11Cl2N3O2S2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 110301352 |
| Molecular Formula | C11H11Cl2N3O2S2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 5,6-dichloro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | Cc1nc(CCNS(=O)(=O)c2cnc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C11H11Cl2N3O2S2/c1-7-16-8(6-19-7)2-3-15-20(17,18)9-4-10(12)11(13)14-5-9/h4-6,15H,2-3H2,1H3 |
| InChIKey | CRQHKQMYXUXIJF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|