C18H17ClFN3OS — CID 110302422
2-chloro-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-7-fluoroquinoline-3-carboxamide (PubChem CID 110302422) has the molecular formula C18H17ClFN3OS and a molecular weight of 377.87 g/mol. Its IUPAC name is 2-chloro-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-7-fluoroquinoline-3-carboxamide.
| Compound Name | 2-chloro-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-7-fluoroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 110302422 |
| Molecular Formula | C18H17ClFN3OS |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-chloro-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-7-fluoroquinoline-3-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1cc2ccc(F)cc2nc1Cl)c1cccs1 |
| InChI | InChI=1S/C18H17ClFN3OS/c1-23(2)15(16-4-3-7-25-16)10-21-18(24)13-8-11-5-6-12(20)9-14(11)22-17(13)19/h3-9,15H,10H2,1-2H3,(H,21,24) |
| InChIKey | XDLCBKGOMLMZPH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|