About decane-2,5-dione
decane-2,5-dione (PubChem CID 11030272) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is decane-2,5-dione.
Molecular Properties
| Compound Name | decane-2,5-dione |
| PubChem CID | 11030272 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | decane-2,5-dione |
| SMILES | CCCCCC(=O)CCC(C)=O |
| InChI | InChI=1S/C10H18O2/c1-3-4-5-6-10(12)8-7-9(2)11/h3-8H2,1-2H3 |
| InChIKey | RJRFVJDPTHVIRV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane-2,5-dione?
The IUPAC name of decane-2,5-dione (CID 11030272) is decane-2,5-dione.
What is the SMILES notation for decane-2,5-dione?
The canonical SMILES for decane-2,5-dione is CCCCCC(=O)CCC(C)=O.
What is the InChIKey of decane-2,5-dione?
The InChIKey is RJRFVJDPTHVIRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-4-5-6-10(12)8-7-9(2)11/h3-8H2,1-2H3.
What are the key properties of decane-2,5-dione?
decane-2,5-dione has a molecular weight of 170.25 g/mol, XLogP of 2.51, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decane-2,5-dione is sourced from PubChem (CID 11030272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).