C16H19N3O6S — CID 110305273
N-cyclopropyl-2-[[5-(2,5-dioxopyrrolidin-1-yl)-2-methoxyphenyl]sulfonylamino]acetamide (PubChem CID 110305273) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[[5-(2,5-dioxopyrrolidin-1-yl)-2-methoxyphenyl]sulfonylamino]acetamide.
| Compound Name | N-cyclopropyl-2-[[5-(2,5-dioxopyrrolidin-1-yl)-2-methoxyphenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 110305273 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-cyclopropyl-2-[[5-(2,5-dioxopyrrolidin-1-yl)-2-methoxyphenyl]sulfonylamino]acetamide |
| SMILES | COc1ccc(N2C(=O)CCC2=O)cc1S(=O)(=O)NCC(=O)NC1CC1 |
| InChI | InChI=1S/C16H19N3O6S/c1-25-12-5-4-11(19-15(21)6-7-16(19)22)8-13(12)26(23,24)17-9-14(20)18-10-2-3-10/h4-5,8,10,17H,2-3,6-7,9H2,1H3,(H,18,20) |
| InChIKey | LBYPMHXZOBLZJQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|