C11H14N2O — CID 11030602
2,6,7-trimethyl-5,8-dihydrophthalazin-1-one (PubChem CID 11030602) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2,6,7-trimethyl-5,8-dihydrophthalazin-1-one.
| Compound Name | 2,6,7-trimethyl-5,8-dihydrophthalazin-1-one |
|---|---|
| PubChem CID | 11030602 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2,6,7-trimethyl-5,8-dihydrophthalazin-1-one |
| SMILES | CC1=C(C)Cc2c(cnn(C)c2=O)C1 |
| InChI | InChI=1S/C11H14N2O/c1-7-4-9-6-12-13(3)11(14)10(9)5-8(7)2/h6H,4-5H2,1-3H3 |
| InChIKey | GOQCXRXRLUNUEY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|