C13H24N2O — CID 153352943
ethane;2-methyl-5,6,7,8-tetrahydrophthalazin-1-one (PubChem CID 153352943) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is ethane;2-methyl-5,6,7,8-tetrahydrophthalazin-1-one.
| Compound Name | ethane;2-methyl-5,6,7,8-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 153352943 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | ethane;2-methyl-5,6,7,8-tetrahydrophthalazin-1-one |
| SMILES | CC.CC.Cn1ncc2c(c1=O)CCCC2 |
| InChI | InChI=1S/C9H12N2O.2C2H6/c1-11-9(12)8-5-3-2-4-7(8)6-10-11;2*1-2/h6H,2-5H2,1H3;2*1-2H3 |
| InChIKey | RKJPZRNYHDEGDC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |