C10H15N3O — CID 82505114
2-(2-aminoethyl)-5,6,7,8-tetrahydrophthalazin-1-one (PubChem CID 82505114) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(2-aminoethyl)-5,6,7,8-tetrahydrophthalazin-1-one.
| Compound Name | 2-(2-aminoethyl)-5,6,7,8-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 82505114 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-(2-aminoethyl)-5,6,7,8-tetrahydrophthalazin-1-one |
| SMILES | NCCn1ncc2c(c1=O)CCCC2 |
| InChI | InChI=1S/C10H15N3O/c11-5-6-13-10(14)9-4-2-1-3-8(9)7-12-13/h7H,1-6,11H2 |
| InChIKey | VNBVMFIRSFRFDU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |