C10H18N2O — CID 170978453
ethane;5-ethyl-2,4-dimethylpyridazin-3-one (PubChem CID 170978453) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is ethane;5-ethyl-2,4-dimethylpyridazin-3-one.
| Compound Name | ethane;5-ethyl-2,4-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 170978453 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | ethane;5-ethyl-2,4-dimethylpyridazin-3-one |
| SMILES | CC.CCc1cnn(C)c(=O)c1C |
| InChI | InChI=1S/C8H12N2O.C2H6/c1-4-7-5-9-10(3)8(11)6(7)2;1-2/h5H,4H2,1-3H3;1-2H3 |
| InChIKey | KUAPKFCUZNHGCP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |