C21H28N2O2S — CID 110310564
1-[3-(3-methoxyphenyl)-4-methylpiperazin-1-yl]-5-thiophen-2-ylpentan-1-one (PubChem CID 110310564) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-[3-(3-methoxyphenyl)-4-methylpiperazin-1-yl]-5-thiophen-2-ylpentan-1-one.
| Compound Name | 1-[3-(3-methoxyphenyl)-4-methylpiperazin-1-yl]-5-thiophen-2-ylpentan-1-one |
|---|---|
| PubChem CID | 110310564 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-[3-(3-methoxyphenyl)-4-methylpiperazin-1-yl]-5-thiophen-2-ylpentan-1-one |
| SMILES | COc1cccc(C2CN(C(=O)CCCCc3cccs3)CCN2C)c1 |
| InChI | InChI=1S/C21H28N2O2S/c1-22-12-13-23(16-20(22)17-7-5-8-18(15-17)25-2)21(24)11-4-3-9-19-10-6-14-26-19/h5-8,10,14-15,20H,3-4,9,11-13,16H2,1-2H3 |
| InChIKey | BPOWYEDWGMLRAN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|