C19H29FN2O — CID 110312935
2-(4-fluorophenyl)-3-methyl-N-(2-methyl-2-pyrrolidin-1-ylpropyl)butanamide (PubChem CID 110312935) has the molecular formula C19H29FN2O and a molecular weight of 320.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-methyl-N-(2-methyl-2-pyrrolidin-1-ylpropyl)butanamide.
| Compound Name | 2-(4-fluorophenyl)-3-methyl-N-(2-methyl-2-pyrrolidin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 110312935 |
| Molecular Formula | C19H29FN2O |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 2-(4-fluorophenyl)-3-methyl-N-(2-methyl-2-pyrrolidin-1-ylpropyl)butanamide |
| SMILES | CC(C)C(C(=O)NCC(C)(C)N1CCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H29FN2O/c1-14(2)17(15-7-9-16(20)10-8-15)18(23)21-13-19(3,4)22-11-5-6-12-22/h7-10,14,17H,5-6,11-13H2,1-4H3,(H,21,23) |
| InChIKey | FLKODSCDSSLJEF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |