C20H25FN2O2 — CID 55378466
5-(4-fluorophenyl)-N-(2-methyl-2-piperidin-1-ylpropyl)furan-2-carboxamide (PubChem CID 55378466) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(2-methyl-2-piperidin-1-ylpropyl)furan-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(2-methyl-2-piperidin-1-ylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 55378466 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(2-methyl-2-piperidin-1-ylpropyl)furan-2-carboxamide |
| SMILES | CC(C)(CNC(=O)c1ccc(-c2ccc(F)cc2)o1)N1CCCCC1 |
| InChI | InChI=1S/C20H25FN2O2/c1-20(2,23-12-4-3-5-13-23)14-22-19(24)18-11-10-17(25-18)15-6-8-16(21)9-7-15/h6-11H,3-5,12-14H2,1-2H3,(H,22,24) |
| InChIKey | GFTDCAJJSFFYEN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |