About 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone
1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone (PubChem CID 110313080) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone |
| PubChem CID | 110313080 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone |
| SMILES | CC1(C)COCCN1C(=O)Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C17H20N2O3/c1-17(2)12-21-9-8-19(17)16(20)11-14-10-15(22-18-14)13-6-4-3-5-7-13/h3-7,10H,8-9,11-12H2,1-2H3 |
| InChIKey | FYHXQVVQDAVDLY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone?
The IUPAC name of 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone (CID 110313080) is 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone.
What is the SMILES notation for 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone?
The canonical SMILES for 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone is CC1(C)COCCN1C(=O)Cc1cc(-c2ccccc2)on1.
What is the InChIKey of 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone?
The InChIKey is FYHXQVVQDAVDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-17(2)12-21-9-8-19(17)16(20)11-14-10-15(22-18-14)13-6-4-3-5-7-13/h3-7,10H,8-9,11-12H2,1-2H3.
What are the key properties of 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone?
1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone has a molecular weight of 300.36 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylmorpholin-4-yl)-2-(5-phenyl-1,2-oxazol-3-yl)ethanone is sourced from PubChem (CID 110313080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).