C21H25N3O — CID 110313770
N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-4-methyl-3-phenylpentanamide (PubChem CID 110313770) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-4-methyl-3-phenylpentanamide.
| Compound Name | N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-4-methyl-3-phenylpentanamide |
|---|---|
| PubChem CID | 110313770 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-(2-imidazo[1,5-a]pyridin-3-ylethyl)-4-methyl-3-phenylpentanamide |
| SMILES | CC(C)C(CC(=O)NCCc1ncc2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O/c1-16(2)19(17-8-4-3-5-9-17)14-21(25)22-12-11-20-23-15-18-10-6-7-13-24(18)20/h3-10,13,15-16,19H,11-12,14H2,1-2H3,(H,22,25) |
| InChIKey | VYMMEZUHOICTCE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |