C20H22ClN3O — CID 110309721
3-(4-chlorophenyl)-N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-2-methylpropanamide (PubChem CID 110309721) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-2-methylpropanamide.
| Compound Name | 3-(4-chlorophenyl)-N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 110309721 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(3-imidazo[1,5-a]pyridin-3-ylpropyl)-2-methylpropanamide |
| SMILES | CC(Cc1ccc(Cl)cc1)C(=O)NCCCc1ncc2ccccn12 |
| InChI | InChI=1S/C20H22ClN3O/c1-15(13-16-7-9-17(21)10-8-16)20(25)22-11-4-6-19-23-14-18-5-2-3-12-24(18)19/h2-3,5,7-10,12,14-15H,4,6,11,13H2,1H3,(H,22,25) |
| InChIKey | ADRSUZLPJKGMBJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|