C17H23N3O3 — CID 110314830
1,1-diethyl-3-[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]ethyl]urea (PubChem CID 110314830) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1,1-diethyl-3-[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]ethyl]urea.
| Compound Name | 1,1-diethyl-3-[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 110314830 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1,1-diethyl-3-[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]ethyl]urea |
| SMILES | CCN(CC)C(=O)NCCc1cc(-c2cccc(OC)c2)on1 |
| InChI | InChI=1S/C17H23N3O3/c1-4-20(5-2)17(21)18-10-9-14-12-16(23-19-14)13-7-6-8-15(11-13)22-3/h6-8,11-12H,4-5,9-10H2,1-3H3,(H,18,21) |
| InChIKey | BZXAWJCQQDXEFA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |