C21H23N3O3 — CID 110634060
N-[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]ethyl]-4-pyridin-3-ylbutanamide (PubChem CID 110634060) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]ethyl]-4-pyridin-3-ylbutanamide.
| Compound Name | N-[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]ethyl]-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110634060 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]ethyl]-4-pyridin-3-ylbutanamide |
| SMILES | COc1cccc(-c2cc(CCNC(=O)CCCc3cccnc3)no2)c1 |
| InChI | InChI=1S/C21H23N3O3/c1-26-19-8-3-7-17(13-19)20-14-18(24-27-20)10-12-23-21(25)9-2-5-16-6-4-11-22-15-16/h3-4,6-8,11,13-15H,2,5,9-10,12H2,1H3,(H,23,25) |
| InChIKey | KCZPHJOHPSPOBB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |