C14H12BrF2NO2S — CID 110316664
4-(2-bromoethyl)-N-(2,6-difluorophenyl)benzenesulfonamide (PubChem CID 110316664) has the molecular formula C14H12BrF2NO2S and a molecular weight of 376.22 g/mol. Its IUPAC name is 4-(2-bromoethyl)-N-(2,6-difluorophenyl)benzenesulfonamide.
| Compound Name | 4-(2-bromoethyl)-N-(2,6-difluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110316664 |
| Molecular Formula | C14H12BrF2NO2S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 4-(2-bromoethyl)-N-(2,6-difluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1c(F)cccc1F)c1ccc(CCBr)cc1 |
| InChI | InChI=1S/C14H12BrF2NO2S/c15-9-8-10-4-6-11(7-5-10)21(19,20)18-14-12(16)2-1-3-13(14)17/h1-7,18H,8-9H2 |
| InChIKey | LPBHTQCDLWBGNJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|