C20H20ClN3O3 — CID 110323943
N-[2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-4-phenoxybutanamide (PubChem CID 110323943) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is N-[2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-4-phenoxybutanamide.
| Compound Name | N-[2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 110323943 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)NCCc1nc(-c2ccccc2Cl)no1 |
| InChI | InChI=1S/C20H20ClN3O3/c21-17-10-5-4-9-16(17)20-23-19(27-24-20)12-13-22-18(25)11-6-14-26-15-7-2-1-3-8-15/h1-5,7-10H,6,11-14H2,(H,22,25) |
| InChIKey | ZDZWJYSHAUJRIU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|