C16H23N3 — CID 11032543
13-phenyl-1,5,9-triazatricyclo[7.3.1.05,13]tridecane (PubChem CID 11032543) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 13-phenyl-1,5,9-triazatricyclo[7.3.1.05,13]tridecane.
| Compound Name | 13-phenyl-1,5,9-triazatricyclo[7.3.1.05,13]tridecane |
|---|---|
| PubChem CID | 11032543 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 13-phenyl-1,5,9-triazatricyclo[7.3.1.05,13]tridecane |
| SMILES | c1ccc(C23N4CCCN2CCCN3CCC4)cc1 |
| InChI | InChI=1S/C16H23N3/c1-2-7-15(8-3-1)16-17-9-4-10-18(16)12-6-14-19(16)13-5-11-17/h1-3,7-8H,4-6,9-14H2 |
| InChIKey | YTKYJJLBJBUBOV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |