C21H26INO2 — CID 175104910
1-(2-methyl-4,4-diphenyl-1,3-dioxolan-2-yl)piperidine;hydroiodide (PubChem CID 175104910) has the molecular formula C21H26INO2 and a molecular weight of 451.35 g/mol. Its IUPAC name is 1-(2-methyl-4,4-diphenyl-1,3-dioxolan-2-yl)piperidine;hydroiodide.
| Compound Name | 1-(2-methyl-4,4-diphenyl-1,3-dioxolan-2-yl)piperidine;hydroiodide |
|---|---|
| PubChem CID | 175104910 |
| Molecular Formula | C21H26INO2 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 1-(2-methyl-4,4-diphenyl-1,3-dioxolan-2-yl)piperidine;hydroiodide |
| SMILES | CC1(N2CCCCC2)OCC(c2ccccc2)(c2ccccc2)O1.I |
| InChI | InChI=1S/C21H25NO2.HI/c1-20(22-15-9-4-10-16-22)23-17-21(24-20,18-11-5-2-6-12-18)19-13-7-3-8-14-19;/h2-3,5-8,11-14H,4,9-10,15-17H2,1H3;1H |
| InChIKey | HWPKAFGIZYRHDQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|