C20H24FNO3S — CID 110327570
4-(4-ethylphenyl)sulfonyl-2-(4-fluorophenyl)-5,5-dimethylmorpholine (PubChem CID 110327570) has the molecular formula C20H24FNO3S and a molecular weight of 377.48 g/mol. Its IUPAC name is 4-(4-ethylphenyl)sulfonyl-2-(4-fluorophenyl)-5,5-dimethylmorpholine.
| Compound Name | 4-(4-ethylphenyl)sulfonyl-2-(4-fluorophenyl)-5,5-dimethylmorpholine |
|---|---|
| PubChem CID | 110327570 |
| Molecular Formula | C20H24FNO3S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-(4-ethylphenyl)sulfonyl-2-(4-fluorophenyl)-5,5-dimethylmorpholine |
| SMILES | CCc1ccc(S(=O)(=O)N2CC(c3ccc(F)cc3)OCC2(C)C)cc1 |
| InChI | InChI=1S/C20H24FNO3S/c1-4-15-5-11-18(12-6-15)26(23,24)22-13-19(25-14-20(22,2)3)16-7-9-17(21)10-8-16/h5-12,19H,4,13-14H2,1-3H3 |
| InChIKey | PHENDMSSXCIVMH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |