C17H27NO3S — CID 110327467
4-butylsulfonyl-5,5-dimethyl-2-(4-methylphenyl)morpholine (PubChem CID 110327467) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is 4-butylsulfonyl-5,5-dimethyl-2-(4-methylphenyl)morpholine.
| Compound Name | 4-butylsulfonyl-5,5-dimethyl-2-(4-methylphenyl)morpholine |
|---|---|
| PubChem CID | 110327467 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-butylsulfonyl-5,5-dimethyl-2-(4-methylphenyl)morpholine |
| SMILES | CCCCS(=O)(=O)N1CC(c2ccc(C)cc2)OCC1(C)C |
| InChI | InChI=1S/C17H27NO3S/c1-5-6-11-22(19,20)18-12-16(21-13-17(18,3)4)15-9-7-14(2)8-10-15/h7-10,16H,5-6,11-13H2,1-4H3 |
| InChIKey | HRUWXDYCGNKCGX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |