C10H15N3O3S2 — CID 110330131
3-(2-amino-1,3-thiazol-4-yl)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 110330131) has the molecular formula C10H15N3O3S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-(2-amino-1,3-thiazol-4-yl)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-(2-amino-1,3-thiazol-4-yl)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 110330131 |
| Molecular Formula | C10H15N3O3S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-(2-amino-1,3-thiazol-4-yl)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | Nc1nc(CCC(=O)NC2CCS(=O)(=O)C2)cs1 |
| InChI | InChI=1S/C10H15N3O3S2/c11-10-13-7(5-17-10)1-2-9(14)12-8-3-4-18(15,16)6-8/h5,8H,1-4,6H2,(H2,11,13)(H,12,14) |
| InChIKey | SDWIQJUWLOMELU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |