C9H15N3S — CID 110337362
1-[(E)-cyclohex-3-en-1-ylmethylideneamino]-3-methylthiourea (PubChem CID 110337362) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 1-[(E)-cyclohex-3-en-1-ylmethylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-cyclohex-3-en-1-ylmethylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 110337362 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-[(E)-cyclohex-3-en-1-ylmethylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C/C1CC=CCC1 |
| InChI | InChI=1S/C9H15N3S/c1-10-9(13)12-11-7-8-5-3-2-4-6-8/h2-3,7-8H,4-6H2,1H3,(H2,10,12,13)/b11-7+ |
| InChIKey | LGSQRANUTLOVNY-YRNVUSSQSA-N |
| XLogP | 1.42 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|