C9H14N2S2 — CID 170856160
methyl N-[(E)-cyclohex-3-en-1-ylmethylideneamino]carbamodithioate (PubChem CID 170856160) has the molecular formula C9H14N2S2 and a molecular weight of 214.36 g/mol. Its IUPAC name is methyl N-[(E)-cyclohex-3-en-1-ylmethylideneamino]carbamodithioate.
| Compound Name | methyl N-[(E)-cyclohex-3-en-1-ylmethylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 170856160 |
| Molecular Formula | C9H14N2S2 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | methyl N-[(E)-cyclohex-3-en-1-ylmethylideneamino]carbamodithioate |
| SMILES | CSC(=S)N/N=C/C1CC=CCC1 |
| InChI | InChI=1S/C9H14N2S2/c1-13-9(12)11-10-7-8-5-3-2-4-6-8/h2-3,7-8H,4-6H2,1H3,(H,11,12)/b10-7+ |
| InChIKey | YORIXKNVBNPRFO-JXMROGBWSA-N |
| XLogP | 2.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|