C28H27N3O2 — CID 110338861
N-[(E)-[4-(2-phenylethoxy)phenyl]methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 110338861) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[(E)-[4-(2-phenylethoxy)phenyl]methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[(E)-[4-(2-phenylethoxy)phenyl]methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 110338861 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[(E)-[4-(2-phenylethoxy)phenyl]methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(OCCc2ccccc2)cc1)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C28H27N3O2/c32-28(22-12-15-27-25(18-22)24-8-4-5-9-26(24)30-27)31-29-19-21-10-13-23(14-11-21)33-17-16-20-6-2-1-3-7-20/h1-3,6-7,10-15,18-19,30H,4-5,8-9,16-17H2,(H,31,32)/b29-19+ |
| InChIKey | MIXWMAFBUPEVPY-VUTHCHCSSA-N |
| XLogP | 5.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|