C24H27N3O3 — CID 112538172
N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 112538172) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 112538172 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)c2ccc3[nH]c4c(c3c2)CCCC4)cc1OC |
| InChI | InChI=1S/C24H27N3O3/c1-3-12-30-22-11-8-16(13-23(22)29-2)15-25-27-24(28)17-9-10-21-19(14-17)18-6-4-5-7-20(18)26-21/h8-11,13-15,26H,3-7,12H2,1-2H3,(H,27,28)/b25-15- |
| InChIKey | DUSLHROPNQRDGQ-MYYYXRDXSA-N |
| XLogP | 4.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|