C24H26ClN3O2 — CID 110511084
N-[(Z)-(3-chloro-4-propoxyphenyl)methylideneamino]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 110511084) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-4-propoxyphenyl)methylideneamino]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[(Z)-(3-chloro-4-propoxyphenyl)methylideneamino]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 110511084 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[(Z)-(3-chloro-4-propoxyphenyl)methylideneamino]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)c2ccc3[nH]c4c(c3c2)CC(C)CC4)cc1Cl |
| InChI | InChI=1S/C24H26ClN3O2/c1-3-10-30-23-9-5-16(12-20(23)25)14-26-28-24(29)17-6-8-22-19(13-17)18-11-15(2)4-7-21(18)27-22/h5-6,8-9,12-15,27H,3-4,7,10-11H2,1-2H3,(H,28,29)/b26-14- |
| InChIKey | CGDRLUDRQOJCOM-WGARJPEWSA-N |
| XLogP | 5.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|